EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H2O4.C5H11NS3 |
| Net Charge | 0 |
| Average Mass | 271.385 |
| Monoisotopic Mass | 271.00067 |
| SMILES | CN(C)C1CSSSC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C5H11NS3.C2H2O4/c1-6(2)5-3-7-9-8-4-5;3-1(4)2(5)6/h5H,3-4H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | ICTQUFQQEYSGGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiocyclam oxalate (CHEBI:133553) has part oxalate(1−) (CHEBI:46904) |
| thiocyclam oxalate (CHEBI:133553) has part thiocyclam(1+) (CHEBI:133552) |
| thiocyclam oxalate (CHEBI:133553) has role agrochemical (CHEBI:33286) |
| thiocyclam oxalate (CHEBI:133553) has role insecticide (CHEBI:24852) |
| thiocyclam oxalate (CHEBI:133553) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| thiocyclam oxalate (CHEBI:133553) is a oxalate salt (CHEBI:64148) |
| IUPAC Name |
|---|
| N,N-dimethyl-1,2,3-trithian-5-aminium hydrogen oxalate |
| Synonyms | Source |
|---|---|
| 5-dimethylamino-1,2,3-trithiane hydrogen oxalate | ChemIDplus |
| N,N-dimethyl-1,2,3-trithian-5-amine ethanedioate (1:1) | Alan Wood's Pesticides |
| N,N-dimethyl-1,2,3-trithian-5-amine hydrogenoxalate | ChemIDplus |
| N,N-dimethyl-1,2,3-trithian-5-ylamine oxalate (1:1) | Alan Wood's Pesticides |
| N,N-dimethyl-1,2,3-trithian-5-ylammonium hydrogen oxalate | ChemIDplus |
| oxalic acid—N,N-dimethyl-1,2,3-trithian-5-amine (1/1) | Alan Wood's Pesticides |
| Brand Names | Source |
|---|---|
| Evisect | ChemIDplus |
| Evisekt | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 753 | PPDB |
| derivatives/thiocyclam%20oxalate | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:31895-22-4 | Alan Wood's Pesticides |
| CAS:31895-22-4 | ChemIDplus |