EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H2O4.C5H11NS3 |
| Net Charge | 0 |
| Average Mass | 271.385 |
| Monoisotopic Mass | 271.00067 |
| SMILES | CN(C)C1CSSSC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C5H11NS3.C2H2O4/c1-6(2)5-3-7-9-8-4-5;3-1(4)2(5)6/h5H,3-4H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | ICTQUFQQEYSGGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiocyclam oxalate (CHEBI:133553) has part oxalate(1−) (CHEBI:46904) |
| thiocyclam oxalate (CHEBI:133553) has part thiocyclam(1+) (CHEBI:133552) |
| thiocyclam oxalate (CHEBI:133553) has role agrochemical (CHEBI:33286) |
| thiocyclam oxalate (CHEBI:133553) has role insecticide (CHEBI:24852) |
| thiocyclam oxalate (CHEBI:133553) has role nicotinic acetylcholine receptor agonist (CHEBI:47958) |
| thiocyclam oxalate (CHEBI:133553) is a oxalate salt (CHEBI:64148) |
| IUPAC Name |
|---|
| N,N-dimethyl-1,2,3-trithian-5-aminium hydrogen oxalate |
| Synonyms | Source |
|---|---|
| 5-dimethylamino-1,2,3-trithiane hydrogen oxalate | ChemIDplus |
| N,N-dimethyl-1,2,3-trithian-5-amine ethanedioate (1:1) | Alan Wood's Pesticides |
| N,N-dimethyl-1,2,3-trithian-5-amine hydrogenoxalate | ChemIDplus |
| N,N-dimethyl-1,2,3-trithian-5-ylamine oxalate (1:1) | Alan Wood's Pesticides |
| N,N-dimethyl-1,2,3-trithian-5-ylammonium hydrogen oxalate | ChemIDplus |
| oxalic acid—N,N-dimethyl-1,2,3-trithian-5-amine (1/1) | Alan Wood's Pesticides |
| Brand Names | Source |
|---|---|
| Evisect | ChemIDplus |
| Evisekt | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 753 | PPDB |
| derivatives/thiocyclam%20oxalate | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:31895-22-4 | Alan Wood's Pesticides |
| CAS:31895-22-4 | ChemIDplus |