EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7O6S |
| Net Charge | -1 |
| Average Mass | 219.194 |
| Monoisotopic Mass | 218.99688 |
| SMILES | COc1c(O)cccc1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H8O6S/c1-12-7-5(8)3-2-4-6(7)13-14(9,10)11/h2-4,8H,1H3,(H,9,10,11)/p-1 |
| InChIKey | ARLAWMCEVZUXEY-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxyresorcinol sulfate(1−) (CHEBI:133550) has role human blood serum metabolite (CHEBI:85234) |
| 2-methoxyresorcinol sulfate(1−) (CHEBI:133550) is a phenyl sulfate oxoanion (CHEBI:140317) |
| 2-methoxyresorcinol sulfate(1−) (CHEBI:133550) is conjugate base of 2-methoxyresorcinol sulfate (CHEBI:133548) |
| Incoming Relation(s) |
| 2-methoxyresorcinol sulfate (CHEBI:133548) is conjugate acid of 2-methoxyresorcinol sulfate(1−) (CHEBI:133550) |
| IUPAC Name |
|---|
| 3-hydroxy-2-methoxyphenyl sulfate |
| Synonyms | Source |
|---|---|
| 2-methoxyresorcinol monosulfate(1−) | ChEBI |
| 2-methylpyrogallol 1-sulfate(1−) | ChEBI |
| 2-methylpyrogallol sulfate(1−) | ChEBI |