EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2S |
| Net Charge | 0 |
| Average Mass | 135.188 |
| Monoisotopic Mass | 135.03540 |
| SMILES | CSC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C4H9NO2S/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | IDIDJDIHTAOVLG-VKHMYHEASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-methylcysteine zwitterion (CHEBI:133545) is a S-alkyl-L-cysteine zwitterion (CHEBI:82710) |
| S-methylcysteine zwitterion (CHEBI:133545) is tautomer of S-methylcysteine (CHEBI:45658) |
| Incoming Relation(s) |
| S-methylcysteine (CHEBI:45658) is tautomer of S-methylcysteine zwitterion (CHEBI:133545) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-(methylsulfanyl)propanoate |
| Synonyms | Source |
|---|---|
| S-methyl-L-cysteine zwitterion | ChEBI |
| methylcysteine zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| S-methyl-L-cysteine | UniProt |