EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8HCl3N2O |
| Net Charge | 0 |
| Average Mass | 247.468 |
| Monoisotopic Mass | 245.91545 |
| SMILES | N#Cc1c(O)c(Cl)c(Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C8HCl3N2O/c9-5-3(1-12)6(10)7(11)8(14)4(5)2-13/h14H |
| InChIKey | MDQKYGOECVSPIW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxychlorothalonil (CHEBI:133542) has functional parent isophthalonitrile (CHEBI:38218) |
| 4-hydroxychlorothalonil (CHEBI:133542) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 4-hydroxychlorothalonil (CHEBI:133542) is a nitrile (CHEBI:18379) |
| 4-hydroxychlorothalonil (CHEBI:133542) is a trichlorophenols (CHEBI:15258) |
| 4-hydroxychlorothalonil (CHEBI:133542) is conjugate acid of 4-hydroxychlorothalonil(1−) (CHEBI:156267) |
| Incoming Relation(s) |
| 4-hydroxychlorothalonil(1−) (CHEBI:156267) is conjugate base of 4-hydroxychlorothalonil (CHEBI:133542) |
| IUPAC Name |
|---|
| 2,4,5-trichloro-6-hydroxybenzene-1,3-dicarbonitrile |
| Synonyms | Source |
|---|---|
| 4-Hydroxy-2,5,6-trichloro-1,3-benzenedicarbonitrile | ChemIDplus |
| 4-Hydroxy-2,5,6-trichloroisophthalonitrile | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0240624 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2653044 | Reaxys |
| CAS:28343-61-5 | ChemIDplus |
| Citations |
|---|