EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9ClN2O4S2 |
| Net Charge | 0 |
| Average Mass | 368.823 |
| Monoisotopic Mass | 367.96923 |
| SMILES | O=C(O)CCN1C(=O)/C(=C2/C(=O)Nc3ccc(Cl)cc32)SC1=S |
| InChI | InChI=1S/C14H9ClN2O4S2/c15-6-1-2-8-7(5-6)10(12(20)16-8)11-13(21)17(14(22)23-11)4-3-9(18)19/h1-2,5H,3-4H2,(H,16,20)(H,18,19)/b11-10- |
| InChIKey | VISHSGZPGQKEFX-KHPPLWFESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FX1 (CHEBI:133537) has functional parent 3-methyleneoxindole (CHEBI:17920) |
| FX1 (CHEBI:133537) has functional parent rhodanine (CHEBI:8830) |
| FX1 (CHEBI:133537) has role antineoplastic agent (CHEBI:35610) |
| FX1 (CHEBI:133537) is a monocarboxylic acid (CHEBI:25384) |
| FX1 (CHEBI:133537) is a organochlorine compound (CHEBI:36683) |
| FX1 (CHEBI:133537) is a oxindoles (CHEBI:38459) |
| FX1 (CHEBI:133537) is a thiazolidinone (CHEBI:48891) |
| IUPAC Name |
|---|
| 3-[(5Z)-5-(5-chloro-2-oxo-1,2-dihydro-3H-indol-3-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23386351 | Reaxys |
| Citations |
|---|