EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO4S |
| Net Charge | 0 |
| Average Mass | 217.246 |
| Monoisotopic Mass | 217.04088 |
| SMILES | [NH3+]CCc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C8H11NO4S/c9-6-5-7-1-3-8(4-2-7)13-14(10,11)12/h1-4H,5-6,9H2,(H,10,11,12) |
| InChIKey | DYDUXGMDSXJQFT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tyramine sulfate zwitterion (CHEBI:133531) has role human urinary metabolite (CHEBI:84087) |
| tyramine sulfate zwitterion (CHEBI:133531) has role human xenobiotic metabolite (CHEBI:76967) |
| tyramine sulfate zwitterion (CHEBI:133531) is a zwitterion (CHEBI:27369) |
| tyramine sulfate zwitterion (CHEBI:133531) is tautomer of tyramine sulfate (CHEBI:133530) |
| Incoming Relation(s) |
| tyramine sulfate (CHEBI:133530) is tautomer of tyramine sulfate zwitterion (CHEBI:133531) |
| IUPAC Name |
|---|
| 4-(2-azaniumylethyl)phenyl sulfate |
| Synonyms | Source |
|---|---|
| tyramine O-sulfate zwitterion | ChEBI |
| tyramine O-sulphate zwitterion | ChEBI |
| tyramine sulphate zwitterion | ChEBI |