EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H48NO7P |
| Net Charge | 0 |
| Average Mass | 493.622 |
| Monoisotopic Mass | 493.31684 |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)O[C@H](CO)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C24H48NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)32-23(21-26)22-31-33(28,29)30-20-19-25(2,3)4/h10-11,23,26H,5-9,12-22H2,1-4H3/b11-10-/t23-/m1/s1 |
| InChIKey | OEJYWQCXHNOOHC-ZXEGGCGDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.1.1.1 (carboxylesterase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of carboxylesterase (EC 3.1.1.1 ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Daphnia galeata metabolite A Daphnia metabolite produced by the species Daphnia galeata. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphocholine (CHEBI:133515) is a [(9Z)-hexadecenoyl]-sn-glycero-3-phosphocholine (CHEBI:140432) |
| 2-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphocholine (CHEBI:133515) is a lysophosphatidylcholine(0:0/16:1) (CHEBI:91298) |
| 2-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphocholine (CHEBI:133515) is a palmitoleic acid (CHEBI:28716) |
| IUPAC Name |
|---|
| (2R)-2-{[(9Z)-hexadec-9-enoyl]oxy}-3-hydroxypropyl 2-(trimethylazaniumyl)ethyl phosphate |
| Synonyms | Source |
|---|---|
| 2-palmitoleoyl-sn-glycero-3-phosphocholine | ChEBI |
| 2-palmitoleoyl-GPC | ChEBI |
| LPC(16:1) | ChEBI |
| GPC(0:0/16:1) | ChEBI |
| PC(16:1) | ChEBI |
| GPC(16:1) | ChEBI |