EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H48NO7P |
| Net Charge | 0 |
| Average Mass | 493.622 |
| Monoisotopic Mass | 493.31684 |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)O[C@H](CO)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C24H48NO7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)32-23(21-26)22-31-33(28,29)30-20-19-25(2,3)4/h10-11,23,26H,5-9,12-22H2,1-4H3/b11-10-/t23-/m1/s1 |
| InChIKey | OEJYWQCXHNOOHC-ZXEGGCGDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. EC 3.1.1.1 (carboxylesterase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of carboxylesterase (EC 3.1.1.1 ). Daphnia galeata metabolite A Daphnia metabolite produced by the species Daphnia galeata. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphocholine (CHEBI:133515) is a [(9Z)-hexadecenoyl]-sn-glycero-3-phosphocholine (CHEBI:140432) |
| 2-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphocholine (CHEBI:133515) is a lysophosphatidylcholine(0:0/16:1) (CHEBI:91298) |
| 2-[(9Z)-hexadecenoyl]-sn-glycero-3-phosphocholine (CHEBI:133515) is a palmitoleic acid (CHEBI:28716) |
| IUPAC Name |
|---|
| (2R)-2-{[(9Z)-hexadec-9-enoyl]oxy}-3-hydroxypropyl 2-(trimethylazaniumyl)ethyl phosphate |
| Synonyms | Source |
|---|---|
| 2-palmitoleoyl-sn-glycero-3-phosphocholine | ChEBI |
| 2-palmitoleoyl-GPC | ChEBI |
| 2-palmitoleoyl-GPC (16:1) | ChEBI |
| GPC(0:0/16:1) | ChEBI |
| GPC(16:1) | ChEBI |
| LPC(0:0/16:1) | ChEBI |