EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O8 |
| Net Charge | 0 |
| Average Mass | 466.571 |
| Monoisotopic Mass | 466.25667 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@H](O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)C2 |
| InChI | InChI=1S/C25H38O8/c1-24-9-7-13(32-23-20(29)18(27)19(28)21(33-23)22(30)31)11-12(24)3-4-14-15-5-6-17(26)25(15,2)10-8-16(14)24/h12-16,18-21,23,27-29H,3-11H2,1-2H3,(H,30,31)/t12-,13+,14+,15+,16+,18+,19+,20-,21+,23-,24+,25+/m1/s1 |
| InChIKey | VFUIRAVTUVCQTF-GYFJWSTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clarias gariepinus (ncbitaxon:13013) | - | PubMed (2937683) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10759475) |
| Roles Classification |
|---|
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etiocholanolone 3-glucuronide (CHEBI:133504) has role human blood serum metabolite (CHEBI:85234) |
| etiocholanolone 3-glucuronide (CHEBI:133504) has role human urinary metabolite (CHEBI:84087) |
| etiocholanolone 3-glucuronide (CHEBI:133504) has role human xenobiotic metabolite (CHEBI:76967) |
| etiocholanolone 3-glucuronide (CHEBI:133504) has role marine xenobiotic metabolite (CHEBI:83399) |
| etiocholanolone 3-glucuronide (CHEBI:133504) is a 17-oxo steroid (CHEBI:19168) |
| etiocholanolone 3-glucuronide (CHEBI:133504) is a steroid glucosiduronic acid (CHEBI:26763) |
| etiocholanolone 3-glucuronide (CHEBI:133504) is conjugate acid of etiocholanolone 3-glucuronide(1−) (CHEBI:133505) |
| Incoming Relation(s) |
| etiocholanolone 3-glucuronide(1−) (CHEBI:133505) is conjugate base of etiocholanolone 3-glucuronide (CHEBI:133504) |
| IUPAC Name |
|---|
| 17-oxo-5β-androstan-3β-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| (3β,5β)-17-oxoandrostan-3-yl β-D-glucopyranosiduronic acid | IUPAC |
| etiocholanolone 3-O-β-D-glucuronide | ChEBI |
| etiocholanolone 3-β-glucuronide | ChEBI |
| etiocholanolone 3-β-D-glucuronide | ChEBI |
| etiocholanolone glucuronide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0004484 | HMDB |
| Citations |
|---|