EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O8 |
| Net Charge | 0 |
| Average Mass | 466.571 |
| Monoisotopic Mass | 466.25667 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@H](O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)C2 |
| InChI | InChI=1S/C25H38O8/c1-24-9-7-13(32-23-20(29)18(27)19(28)21(33-23)22(30)31)11-12(24)3-4-14-15-5-6-17(26)25(15,2)10-8-16(14)24/h12-16,18-21,23,27-29H,3-11H2,1-2H3,(H,30,31)/t12-,13+,14+,15+,16+,18+,19+,20-,21+,23-,24+,25+/m1/s1 |
| InChIKey | VFUIRAVTUVCQTF-GYFJWSTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clarias gariepinus (ncbitaxon:13013) | - | PubMed (2937683) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (10759475) |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etiocholanolone 3-glucuronide (CHEBI:133504) has role human blood serum metabolite (CHEBI:85234) |
| etiocholanolone 3-glucuronide (CHEBI:133504) has role human urinary metabolite (CHEBI:84087) |
| etiocholanolone 3-glucuronide (CHEBI:133504) has role human xenobiotic metabolite (CHEBI:76967) |
| etiocholanolone 3-glucuronide (CHEBI:133504) has role marine xenobiotic metabolite (CHEBI:83399) |
| etiocholanolone 3-glucuronide (CHEBI:133504) is a 17-oxo steroid (CHEBI:19168) |
| etiocholanolone 3-glucuronide (CHEBI:133504) is a steroid glucosiduronic acid (CHEBI:26763) |
| etiocholanolone 3-glucuronide (CHEBI:133504) is conjugate acid of etiocholanolone 3-glucuronide(1−) (CHEBI:133505) |
| Incoming Relation(s) |
| etiocholanolone 3-glucuronide(1−) (CHEBI:133505) is conjugate base of etiocholanolone 3-glucuronide (CHEBI:133504) |
| IUPAC Name |
|---|
| 17-oxo-5β-androstan-3β-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| (3β,5β)-17-oxoandrostan-3-yl β-D-glucopyranosiduronic acid | IUPAC |
| etiocholanolone 3-O-β-D-glucuronide | ChEBI |
| etiocholanolone 3-β-glucuronide | ChEBI |
| etiocholanolone 3-β-D-glucuronide | ChEBI |
| etiocholanolone glucuronide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0004484 | HMDB |
| Citations |
|---|