EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O5S |
| Net Charge | -2 |
| Average Mass | 220.246 |
| Monoisotopic Mass | 220.04164 |
| SMILES | CSCCCC(C(=O)[O-])C(O)C(=O)[O-] |
| InChI | InChI=1S/C8H14O5S/c1-14-4-2-3-5(7(10)11)6(9)8(12)13/h5-6,9H,2-4H2,1H3,(H,10,11)(H,12,13)/p-2 |
| InChIKey | SQXVIIOPMYSNCP-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3-methylthio)propylmalate(2−) (CHEBI:133501) is a 3-(ω-methylthio)alkylmalate(2−) (CHEBI:133496) |
| 3-(3-methylthio)propylmalate(2−) (CHEBI:133501) is conjugate base of 3-(3-methylthio)propylmalic acid (CHEBI:134537) |
| Incoming Relation(s) |
| 3-(3-methylthio)propylmalic acid (CHEBI:134537) is conjugate acid of 3-(3-methylthio)propylmalate(2−) (CHEBI:133501) |
| IUPAC Name |
|---|
| 2-hydroxy-3-[3-(methylsulfanyl)propyl]butanedioate |
| UniProt Name | Source |
|---|---|
| 3-(3-methylsulfanyl)propylmalate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPDQT-36 | MetaCyc |