EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O4S |
| Net Charge | -2 |
| Average Mass | 188.204 |
| Monoisotopic Mass | 188.01543 |
| SMILES | CSCC/C(=C/C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H10O4S/c1-12-3-2-5(7(10)11)4-6(8)9/h4H,2-3H2,1H3,(H,8,9)(H,10,11)/p-2/b5-4- |
| InChIKey | FCGNCJNTFRMBQY-PLNGDYQASA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-methylthio)ethylmaleate(2−) (CHEBI:133499) is a 2-(ω-methylthio)alkylmaleate(2−) (CHEBI:133498) |
| 2-(2-methylthio)ethylmaleate(2−) (CHEBI:133499) is conjugate base of 2-(2-methylthio)ethylmaleic acid (CHEBI:134535) |
| Incoming Relation(s) |
| 2-(2-methylthio)ethylmaleic acid (CHEBI:134535) is conjugate acid of 2-(2-methylthio)ethylmaleate(2−) (CHEBI:133499) |
| IUPAC Name |
|---|
| (2Z)-2-[2-(methylsulfanyl)ethyl]but-2-enedioate |
| UniProt Name | Source |
|---|---|
| 2-(2-methylsulfanyl)ethylmaleate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19476 | MetaCyc |