EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N2O5 |
| Net Charge | -2 |
| Average Mass | 288.259 |
| Monoisotopic Mass | 288.07572 |
| SMILES | O=C([O-])C[C@H](NC(=O)Cc1cnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C14H14N2O5/c17-12(16-11(14(20)21)6-13(18)19)5-8-7-15-10-4-2-1-3-9(8)10/h1-4,7,11,15H,5-6H2,(H,16,17)(H,18,19)(H,20,21)/p-2/t11-/m0/s1 |
| InChIKey | VAFNMNRKDDAKRM-NSHDSACASA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(indole-3-acetyl)-L-aspartate(2−) (CHEBI:133482) has role plant metabolite (CHEBI:76924) |
| N-(indole-3-acetyl)-L-aspartate(2−) (CHEBI:133482) is a N-acyl-L-aspartate(2−) (CHEBI:58497) |
| N-(indole-3-acetyl)-L-aspartate(2−) (CHEBI:133482) is conjugate base of N-(indole-3-acetyl)-L-aspartic acid (CHEBI:21484) |
| Incoming Relation(s) |
| N-(indole-3-acetyl)-L-aspartic acid (CHEBI:21484) is conjugate acid of N-(indole-3-acetyl)-L-aspartate(2−) (CHEBI:133482) |
| IUPAC Name |
|---|
| (2S)-2-[2-(1H-indol-3-yl)acetamido]butanedioate |
| Synonyms | Source |
|---|---|
| indole-3-acetyl-aspartate | ChEBI |
| indole-3-acetylaspartate | ChEBI |
| N-(indole-3-acetyl)aspartate(2−) | ChEBI |
| indole-3-acetyl-aspartate(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| (indol-3-yl)acetyl-L-aspartate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| INDOLE-3-ACETYL-ASP | MetaCyc |