EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11O3 |
| Net Charge | -1 |
| Average Mass | 215.228 |
| Monoisotopic Mass | 215.07137 |
| SMILES | C[C@H](C(=O)[O-])c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C13H12O3/c1-8(13(15)16)9-2-3-11-7-12(14)5-4-10(11)6-9/h2-8,14H,1H3,(H,15,16)/p-1/t8-/m0/s1 |
| InChIKey | XWJUDDGELKXYNO-QMMMGPOBSA-M |
| Roles Classification |
|---|
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desmethylnaproxen(1−) (CHEBI:133481) has role drug metabolite (CHEBI:49103) |
| desmethylnaproxen(1−) (CHEBI:133481) has role human blood serum metabolite (CHEBI:85234) |
| desmethylnaproxen(1−) (CHEBI:133481) has role human urinary metabolite (CHEBI:84087) |
| desmethylnaproxen(1−) (CHEBI:133481) is a monocarboxylic acid anion (CHEBI:35757) |
| desmethylnaproxen(1−) (CHEBI:133481) is conjugate base of desmethylnaproxen (CHEBI:133474) |
| Incoming Relation(s) |
| desmethylnaproxen (CHEBI:133474) is conjugate acid of desmethylnaproxen(1−) (CHEBI:133481) |
| IUPAC Name |
|---|
| (2S)-2-(6-hydroxynaphthalen-2-yl)propanoate |
| Synonym | Source |
|---|---|
| desmethylnaproxen anion | ChEBI |