EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N5O6 |
| Net Charge | 0 |
| Average Mass | 383.405 |
| Monoisotopic Mass | 383.18048 |
| SMILES | CC(CO)CCNc1ncnc2ncn([C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C16H25N5O6/c1-8(4-22)2-3-17-14-10-15(19-6-18-14)20-7-21(10)16-13(26)12(25)11(24)9(5-23)27-16/h6-9,11-13,16,22-26H,2-5H2,1H3,(H,17,18,19)/t8?,9-,11-,12+,13-,16+/m1/s1 |
| InChIKey | WSELIHNWDGFXRQ-CLORPHGJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-(α-D-glucosyl)dihydrozeatin (CHEBI:133475) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 7-(α-D-glucosyl)dihydrozeatin (CHEBI:133475) is a N-glycosyldihydrozeatin (CHEBI:38638) |
| IUPAC Name |
|---|
| 7-α-D-glucopyranosyl-N-(4-hydroxy-3-methylbutyl)-7H-purin-6-amine |
| Synonyms | Source |
|---|---|
| dihydrozeatin-7-N-glucose | MetaCyc |
| cis-zeatin-7-glucoside | ChEBI |
| cis-zeatin-7-α-glucoside | ChEBI |
| cis-zeatin-7-α-D-glucoside | ChEBI |
| (Z)-zeatin-7-N-glucoside | ChEBI |
| (Z)-zeatin-7-glucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| dihydrozeatin-7-N-glucose | MetaCyc |
| Citations |
|---|