EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H58O10 |
| Net Charge | 0 |
| Average Mass | 626.828 |
| Monoisotopic Mass | 626.40300 |
| SMILES | [H][C@@]12CC(=O)[C@@]3([H])C[C@H](O)[C@H](O)C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@H](O)[C@H](O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@@H](C)C(C)C |
| InChI | InChI=1S/C34H58O10/c1-15(2)16(3)31(44-32-30(42)29(41)28(40)26(14-35)43-32)27(39)17(4)19-7-8-20-18-11-23(36)22-12-24(37)25(38)13-34(22,6)21(18)9-10-33(19,20)5/h15-22,24-32,35,37-42H,7-14H2,1-6H3/t16-,17-,18-,19+,20-,21-,22+,24-,25+,26+,27+,28+,29-,30+,31+,32+,33+,34+/m0/s1 |
| InChIKey | OZXMTRULWNHBRI-JGRCFTTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| castasterone 23-O-α-D-glucoside (CHEBI:133472) has functional parent castasterone (CHEBI:23051) |
| castasterone 23-O-α-D-glucoside (CHEBI:133472) has role plant metabolite (CHEBI:76924) |
| castasterone 23-O-α-D-glucoside (CHEBI:133472) is a 22-hydroxy steroid (CHEBI:36863) |
| castasterone 23-O-α-D-glucoside (CHEBI:133472) is a 2α-hydroxy steroid (CHEBI:36858) |
| castasterone 23-O-α-D-glucoside (CHEBI:133472) is a 3α-hydroxy steroid (CHEBI:36835) |
| castasterone 23-O-α-D-glucoside (CHEBI:133472) is a 6-oxo steroid (CHEBI:36883) |
| castasterone 23-O-α-D-glucoside (CHEBI:133472) is a brassinosteroid (CHEBI:22921) |
| castasterone 23-O-α-D-glucoside (CHEBI:133472) is a steroid saponin (CHEBI:61655) |
| castasterone 23-O-α-D-glucoside (CHEBI:133472) is a α-D-glucoside (CHEBI:22390) |
| IUPAC Name |
|---|
| (2α,3α,5α,22R,23R,24S)-2,3,22-trihydroxy-6-oxoergostan-23-yl α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| castasterone 23-O-glucoside | MetaCyc |
| castasterone 23-O-α-glucoside | MetaCyc |
| castasterone-23-O-glucoside | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| castasterone-23-O-glucoside | MetaCyc |