EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O8S2 |
| Net Charge | 0 |
| Average Mass | 480.645 |
| Monoisotopic Mass | 480.18516 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@@H](C)OS(=O)(=O)O)[C@@]1(C)CCC(OS(=O)(=O)O)C2 |
| InChI | InChI=1S/C21H36O8S2/c1-13(28-30(22,23)24)17-6-7-18-16-5-4-14-12-15(29-31(25,26)27)8-10-20(14,2)19(16)9-11-21(17,18)3/h13-19H,4-12H2,1-3H3,(H,22,23,24)(H,25,26,27)/t13-,14+,15?,16+,17-,18+,19+,20+,21-/m1/s1 |
| InChIKey | LSQGWMYMIHQKSA-PKGCTGQPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-pregnane-3,20β-diol disulfate (CHEBI:133464) is a steroid sulfate (CHEBI:16158) |
| 5α-pregnane-3,20β-diol disulfate (CHEBI:133464) is conjugate acid of 5α-pregnane-3,20β-diol disulfate anion (CHEBI:133466) |
| 5α-pregnane-3,20β-diol disulfate (CHEBI:133464) is conjugate acid of 5α-pregnane-3,20β-diol disulfate(2−) (CHEBI:133467) |
| Incoming Relation(s) |
| 5α-pregnane-3,20β-diol disulfate anion (CHEBI:133466) is conjugate base of 5α-pregnane-3,20β-diol disulfate (CHEBI:133464) |
| 5α-pregnane-3,20β-diol disulfate(2−) (CHEBI:133467) is conjugate base of 5α-pregnane-3,20β-diol disulfate (CHEBI:133464) |
| IUPAC Name |
|---|
| (20R)-5α-pregnane-3,20-diyl bis(hydrogen sulfate) |
| Synonyms | Source |
|---|---|
| (5α,20R)-pregnane-3,20-diyl bis(hydrogen sulfate) | IUPAC |
| 5α-pregnane-3,20R-diol disulfate | ChEBI |