EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31O7 |
| Net Charge | -1 |
| Average Mass | 383.461 |
| Monoisotopic Mass | 383.20753 |
| SMILES | O=C([O-])CCC[C@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\CCCCC(O)(O)O |
| InChI | InChI=1S/C20H32O7/c21-17(11-6-2-1-5-9-16-20(25,26)27)12-7-3-4-8-13-18(22)14-10-15-19(23)24/h2-4,6-8,12-13,17-18,21-22,25-27H,1,5,9-11,14-16H2,(H,23,24)/p-1/b4-3+,6-2-,12-7+,13-8-/t17-,18-/m1/s1 |
| InChIKey | UZWWTCBNUQJEPB-QAASZIRWSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20,20,20-trihydroxyleukotriene B4(1−) (CHEBI:133434) is a leukotriene anion (CHEBI:62942) |
| 20,20,20-trihydroxyleukotriene B4(1−) (CHEBI:133434) is conjugate base of 20,20,20-trihydroxyleukotriene B4 (CHEBI:134515) |
| Incoming Relation(s) |
| 20,20,20-trihydroxyleukotriene B4 (CHEBI:134515) is conjugate acid of 20,20,20-trihydroxyleukotriene B4(1−) (CHEBI:133434) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,12R,14Z)-5,12,20,20,20-pentahydroxyicosa-6,8,10,14-tetraenoate |
| Synonym | Source |
|---|---|
| 20-trihydroxy-leukotriene B4(1−) | ChEBI |