EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2O15P2 |
| Net Charge | 0 |
| Average Mass | 548.331 |
| Monoisotopic Mass | 548.08084 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)O2)c(=O)nc1=O |
| InChI | InChI=1S/C16H26N2O15P2/c1-6-4-18(16(24)17-14(6)23)10-3-8(19)9(31-10)5-29-34(25,26)33-35(27,28)32-15-13(22)12(21)11(20)7(2)30-15/h4,7-13,15,19-22H,3,5H2,1-2H3,(H,25,26)(H,27,28)(H,17,23,24)/t7-,8-,9+,10+,11-,12+,13+,15-/m0/s1 |
| InChIKey | ZOSQFDVXNQFKBY-GPNJKSCQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTDP-α-L-rhamnose (CHEBI:133429) has role plant metabolite (CHEBI:76924) |
| dTDP-α-L-rhamnose (CHEBI:133429) is a dTDP-L-rhamnose (CHEBI:35452) |
| IUPAC Name |
|---|
| thymidine 5'-[3-(6-deoxy-α-L-mannopyranosyl) dihydrogen diphosphate] |
| Synonym | Source |
|---|---|
| dTDP-6-deoxy-α-L-mannose | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 24785462 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23093886 | Reaxys |
| Citations |
|---|