EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27O4 |
| Net Charge | -1 |
| Average Mass | 331.432 |
| Monoisotopic Mass | 331.19148 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C1=C(C/C=C\CCCC(=O)[O-])C(=O)CC1 |
| InChI | InChI=1S/C20H28O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h3-4,6-7,12,14,17,21H,2,5,8-11,13,15H2,1H3,(H,23,24)/p-1/b6-3-,7-4-,14-12+/t17-/m0/s1 |
| InChIKey | DQRGQQAJYRBDRP-UNBCGXALSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin B3(1−) (CHEBI:133425) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| prostaglandin B3(1−) (CHEBI:133425) is conjugate base of prostaglandin B3 (CHEBI:134511) |
| Incoming Relation(s) |
| prostaglandin B3 (CHEBI:134511) is conjugate acid of prostaglandin B3(1−) (CHEBI:133425) |
| IUPAC Name |
|---|
| (5Z,13E,15S,17Z)-15-hydroxy-9-oxoprosta-5,8(12),13,17-tetraen-1-oate |
| Synonym | Source |
|---|---|
| PGB3(1−) | ChEBI |