EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35O5 |
| Net Charge | -1 |
| Average Mass | 355.495 |
| Monoisotopic Mass | 355.24900 |
| SMILES | CCCCCC(=O)CC[C@@H]1[C@@H](CCCCCCC(=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h16-19,22-23H,2-14H2,1H3,(H,24,25)/p-1/t16-,17-,18+,19-/m1/s1 |
| InChIKey | FVPKMMQYALWZHV-AKHDSKFASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydro-15-keto-PGF1α(1−) (CHEBI:133411) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| 13,14-dihydro-15-keto-PGF1α(1−) (CHEBI:133411) is conjugate base of 13,14-dihydro-15-keto-PGF1α (CHEBI:134509) |
| Incoming Relation(s) |
| 13,14-dihydro-15-keto-PGF1α (CHEBI:134509) is conjugate acid of 13,14-dihydro-15-keto-PGF1α(1−) (CHEBI:133411) |
| IUPAC Name |
|---|
| (9α,11α)-9,11-dihydroxy-15-oxoprostan-1-oate |
| Synonyms | Source |
|---|---|
| 13,14-dihydro-15-oxo-PGF1α(1−) | ChEBI |
| 13,14-dihydro-15-oxoprostaglandin F1α(1−) | ChEBI |
| 9α,11α-dihydroxy-15-oxoprostan-1-oate | ChEBI |
| UniProt Name | Source |
|---|---|
| 13,14-dihydro-15-oxo-prostaglandin F1α | UniProt |
| Citations |
|---|