EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23N3O4S |
| Net Charge | 0 |
| Average Mass | 473.554 |
| Monoisotopic Mass | 473.14093 |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=S)NC(=O)c4ccccc4C)cc3)c2cc1OC |
| InChI | InChI=1S/C26H23N3O4S/c1-16-6-4-5-7-19(16)25(30)29-26(34)28-17-8-10-18(11-9-17)33-22-12-13-27-21-15-24(32-3)23(31-2)14-20(21)22/h4-15H,1-3H3,(H2,28,29,30,34) |
| InChIKey | ZXGIBSBJQLLUEE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor An EC 2.7.10.* (protein-tyrosine kinase) inhibitor that interferes with the action of receptor protein-tyrosine kinase (EC 2.7.10.1). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ki11502 (CHEBI:133397) has role antineoplastic agent (CHEBI:35610) |
| Ki11502 (CHEBI:133397) has role apoptosis inducer (CHEBI:68495) |
| Ki11502 (CHEBI:133397) has role EC 2.7.10.1 (receptor protein-tyrosine kinase) inhibitor (CHEBI:62434) |
| Ki11502 (CHEBI:133397) is a aromatic ether (CHEBI:35618) |
| Ki11502 (CHEBI:133397) is a benzamides (CHEBI:22702) |
| Ki11502 (CHEBI:133397) is a quinolines (CHEBI:26513) |
| Ki11502 (CHEBI:133397) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| N-({4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}carbamothioyl)-2-methylbenzamide |
| Synonyms | Source |
|---|---|
| N-(4-((6,7-dimethoxy-4-quinoyl)oxy)phenyl)-N'-(2-methylbenzoyl)thiourea | SUBMITTER |
| PDGFR tyrosine kinase inhibitor V | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10488231 | Reaxys |
| CAS:347155-76-4 | SUBMITTER |
| Citations |
|---|