EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N2O8 |
| Net Charge | 0 |
| Average Mass | 386.316 |
| Monoisotopic Mass | 386.07502 |
| SMILES | O=C(O)C1=N[C@H](C(=O)O)CC(C=CN2C3=CC(=O)C(=O)C=C3C[C@H]2C(=O)O)=C1 |
| InChI | InChI=1S/C18H14N2O8/c21-14-6-9-5-13(18(27)28)20(12(9)7-15(14)22)2-1-8-3-10(16(23)24)19-11(4-8)17(25)26/h1-3,6-7,11,13H,4-5H2,(H,23,24)(H,25,26)(H,27,28)/t11-,13-/m0/s1 |
| InChIKey | WAVPHGICHZOYMQ-AAEUAGOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS118) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS117) | ||
| seed (BTO:0001226) | PubMed (25369450) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betanidin quinone (CHEBI:133394) has functional parent betanidin (CHEBI:3079) |
| betanidin quinone (CHEBI:133394) is a dihydropyridine (CHEBI:50075) |
| betanidin quinone (CHEBI:133394) is a indoledione (CHEBI:24793) |
| betanidin quinone (CHEBI:133394) is a olefinic compound (CHEBI:78840) |
| betanidin quinone (CHEBI:133394) is a orthoquinones (CHEBI:25622) |
| betanidin quinone (CHEBI:133394) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| (2S)-4-{2-[(2S)-2-carboxy-5,6-dioxo-2,3,5,6-tetrahydro-1H-indol-1-yl]ethenyl}-2,3-dihydropyridine-2,6-dicarboxylic acid |
| Synonym | Source |
|---|---|
| betanidin o-quinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22023762 | Reaxys |
| Citations |
|---|