EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O3 |
| Net Charge | 0 |
| Average Mass | 140.138 |
| Monoisotopic Mass | 140.04734 |
| SMILES | C=C1CC1CC(=O)C(=O)O |
| InChI | InChI=1S/C7H8O3/c1-4-2-5(4)3-6(8)7(9)10/h5H,1-3H2,(H,9,10) |
| InChIKey | IKTGVEIOCJLOFU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| seed (BTO:0001226) | PubMed (25369450) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS118) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS117) | ||
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (518564) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-(methylenecyclopropyl)pyruvic acid (CHEBI:133390) has functional parent pyruvic acid (CHEBI:32816) |
| β-(methylenecyclopropyl)pyruvic acid (CHEBI:133390) has role rat metabolite (CHEBI:86264) |
| β-(methylenecyclopropyl)pyruvic acid (CHEBI:133390) has role xenobiotic metabolite (CHEBI:76206) |
| β-(methylenecyclopropyl)pyruvic acid (CHEBI:133390) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| β-(methylenecyclopropyl)pyruvic acid (CHEBI:133390) is a cyclopropanes (CHEBI:51454) |
| β-(methylenecyclopropyl)pyruvic acid (CHEBI:133390) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 3-(2-methylidenecyclopropyl)-2-oxopropanoic acid |
| Synonyms | Source |
|---|---|
| 2-methylene-alpha-oxocyclopropanepropanoic acid | MetaCyc |
| 3-(methylenecyclopropyl)pyruvic acid | ChEBI |
| Ketohypoglycin | ChemIDplus |
| methylenecyclopropylpyruvic acid | ChEBI |
| Citations |
|---|