EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4O3 |
| Net Charge | 0 |
| Average Mass | 112.084 |
| Monoisotopic Mass | 112.01604 |
| SMILES | C=C=CC(=O)C(=O)O |
| InChI | InChI=1S/C5H4O3/c1-2-3-4(6)5(7)8/h3H,1H2,(H,7,8) |
| InChIKey | BHAKTUBFIPSXEW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| seed (BTO:0001226) | PubMed (25369450) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS117) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS118) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxopenta-3,4-dienoic acid (CHEBI:133363) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxopenta-3,4-dienoic acid (CHEBI:133363) is a allenes (CHEBI:37602) |
| 2-oxopenta-3,4-dienoic acid (CHEBI:133363) is a enone (CHEBI:51689) |
| IUPAC Name |
|---|
| 2-oxopenta-3,4-dienoic acid |
| Synonym | Source |
|---|---|
| 2-ketopenta-3,4-dienoic acid | ChEBI |