EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O3 |
| Net Charge | 0 |
| Average Mass | 296.451 |
| Monoisotopic Mass | 296.23514 |
| SMILES | [H]C(=O)CCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O3/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21/h1-2,17H,3-16H2,(H,20,21)/b2-1- |
| InChIKey | SNOSCANYFCXCGY-UPHRSURJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS117) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS118) | ||
| seed (BTO:0001226) | PubMed (25369450) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-oxooleic acid (CHEBI:133357) has functional parent oleic acid (CHEBI:16196) |
| 18-oxooleic acid (CHEBI:133357) is a monounsaturated fatty acid (CHEBI:25413) |
| 18-oxooleic acid (CHEBI:133357) is a ω-oxo fatty acid (CHEBI:76328) |
| IUPAC Name |
|---|
| (9Z)-18-oxooctadec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 18-oxo-9Z-octadecenoate | MetaCyc |
| 18-oxo-octadec-9-enoic acid | MetaCyc |
| 18-Oxooleate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 18-OXOOLEATE | MetaCyc |
| 30790941 | ChemSpider |
| C19617 | KEGG COMPOUND |