EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | [H][C@@]12Oc3cc(O)ccc3[C@]1(O)COc1cc(OC)c(CC=C(C)C)cc12 |
| InChI | InChI=1S/C21H22O5/c1-12(2)4-5-13-8-15-18(10-17(13)24-3)25-11-21(23)16-7-6-14(22)9-19(16)26-20(15)21/h4,6-10,20,22-23H,5,11H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | WOKIXZBYDPTMJD-LEWJYISDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| seed (BTO:0001226) | PubMed (25369450) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS117) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS118) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyceollin IV (CHEBI:133347) has role plant metabolite (CHEBI:76924) |
| glyceollin IV (CHEBI:133347) is a aromatic ether (CHEBI:35618) |
| glyceollin IV (CHEBI:133347) is a phenols (CHEBI:33853) |
| glyceollin IV (CHEBI:133347) is a pterocarpans (CHEBI:26377) |
| IUPAC Name |
|---|
| (6aS,11aS)-3-methoxy-2-(3-methylbut-2-en-1-yl)-6H-[1]benzofuro[3,2-c][1]benzopyran-6a,9(11aH)-diol |
| Synonym | Source |
|---|---|
| 6a,9-Dihydroxy-3-methoxy-2-prenylpterocarpan | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMPK12070117 | LIPID MAPS |
| C00009690 | KNApSAcK |
| WO2012006750 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:69393-94-8 | KNApSAcK |
| Citations |
|---|