EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CCCC/C=C/O/C=C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-13-16-21-17-14-11-9-7-5-6-8-10-12-15-18(19)20/h9,11,13-14,16-17H,2-8,10,12,15H2,1H3,(H,19,20)/b11-9-,16-13+,17-14+ |
| InChIKey | NQNHRHWFZHFAAH-XSWVPMOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| - | MetaboLights (MTBLS118) | ||
| - | PubMed (25369450) | ||
| - | MetaboLights (MTBLS117) | ||
| Allium sativum (ncbitaxon:4682) | - | PubMed (18326559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etheroleic acid (CHEBI:133329) is a divinyl ether fatty acid (CHEBI:61411) |
| etheroleic acid (CHEBI:133329) is a long-chain fatty acid (CHEBI:15904) |
| etheroleic acid (CHEBI:133329) is conjugate acid of etheroleate (CHEBI:229759) |
| Incoming Relation(s) |
| etheroleate (CHEBI:229759) is conjugate base of etheroleic acid (CHEBI:133329) |
| IUPAC Name |
|---|
| (9Z,11E)-12-{[(1E)-hex-1-en-1-yl]oxy}dodeca-9,11-dienoic acid |
| Synonyms | Source |
|---|---|
| 12-(1'E-hexaenyloxy)-9Z,11E-dodecadienoic acid | LIPID MAPS |
| 12-[(1E)-1-hexenyloxy]-9Z,11E-dodecadienoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA10000008 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7705995 | Reaxys |
| CAS:169217-38-3 | ChEBI |
| Citations |
|---|