EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10Cl2F3N3O2S |
| Net Charge | 0 |
| Average Mass | 400.209 |
| Monoisotopic Mass | 398.98229 |
| SMILES | CC(=O)c1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1S(C)=O |
| InChI | InChI=1S/C13H10Cl2F3N3O2S/c1-5(22)9-11(24(2)23)12(19)21(20-9)10-7(14)3-6(4-8(10)15)13(16,17)18/h3-4H,19H2,1-2H3 |
| InChIKey | GDZNYEZGJAFIKA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetoprole (CHEBI:133321) has role acaricide (CHEBI:22153) |
| acetoprole (CHEBI:133321) has role GABA-gated chloride channel antagonist (CHEBI:38999) |
| acetoprole (CHEBI:133321) has role nematicide (CHEBI:25491) |
| acetoprole (CHEBI:133321) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| acetoprole (CHEBI:133321) is a aromatic ketone (CHEBI:76224) |
| acetoprole (CHEBI:133321) is a dichlorobenzene (CHEBI:23697) |
| acetoprole (CHEBI:133321) is a phenylpyrazole insecticide (CHEBI:39090) |
| acetoprole (CHEBI:133321) is a primary amino compound (CHEBI:50994) |
| acetoprole (CHEBI:133321) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 1-{5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(methylsulfinyl)-1H-pyrazol-3-yl}ethanone |
| Synonyms | Source |
|---|---|
| 1-[5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(methylsulfinyl)-1H-pyrazol-3-yl]ethanone | Alan Wood's Pesticides |
| 1-[5-amino-1-(2,6-dichloro-α,α,α-trifluoro-p-tolyl)-4-(methylsulfinyl)pyrazol-3-yl]ethanone | Alan Wood's Pesticides |
| acétoprole | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2696 | PPDB |
| acetoprole | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15730946 | Reaxys |
| CAS:209861-58-5 | Alan Wood's Pesticides |
| CAS:209861-58-5 | ChemIDplus |