EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:13332 - GDP-β-L-fucose
| Formula | C16H25N5O15P2 |
| Net Charge | 0 |
| Average Mass | 589.344 |
| Monoisotopic Mass | 589.08224 |
| SMILES | C[C@@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(=O)nc(N)nc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H25N5O15P2/c1-4-7(22)9(24)11(26)15(33-4)35-38(30,31)36-37(28,29)32-2-5-8(23)10(25)14(34-5)21-3-18-6-12(21)19-16(17)20-13(6)27/h3-5,7-11,14-15,22-26H,2H2,1H3,(H,28,29)(H,30,31)(H3,17,19,20,27)/t4-,5+,7+,8+,9+,10+,11-,14+,15+/m0/s1 |
| InChIKey | LQEBEXMHBLQMDB-JGQUBWHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | DOI (10.1104/pp.103.022368) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDP-β-L-fucose (CHEBI:13332) has role mouse metabolite (CHEBI:75771) |
| GDP-β-L-fucose (CHEBI:13332) has role plant metabolite (CHEBI:76924) |
| GDP-β-L-fucose (CHEBI:13332) is a GDP-L-fucose (CHEBI:17009) |
| GDP-β-L-fucose (CHEBI:13332) is conjugate acid of GDP-β-L-fucose(2−) (CHEBI:57273) |
| Incoming Relation(s) |
| GDP-β-L-fucose(2−) (CHEBI:57273) is conjugate base of GDP-β-L-fucose (CHEBI:13332) |
| IUPAC Name |
|---|
| guanosine 5'-[3-(6-deoxy-β-L-galactopyranosyl) dihydrogen diphosphate] |
| Synonym | Source |
|---|---|
| GDP-beta-L-fucose | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:75468 | Reaxys |
| CAS:15839-70-0 | ChemIDplus |
| Citations |
|---|