EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | COc1ccc([C@@H]2C(=O)c3c(O)cc(O)cc3O[C@H]2O)cc1 |
| InChI | InChI=1S/C16H14O6/c1-21-10-4-2-8(3-5-10)13-15(19)14-11(18)6-9(17)7-12(14)22-16(13)20/h2-7,13,16-18,20H,1H3/t13-,16-/m1/s1 |
| InChIKey | IIQJLBKXWGKSKE-CZUORRHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| - | MetaboLights (MTBLS117) | ||
| - | PubMed (25369450) | ||
| - | MetaboLights (MTBLS118) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5,7-trihydroxy-4'-methoxyisoflavanone (CHEBI:133308) has role plant metabolite (CHEBI:76924) |
| 2,5,7-trihydroxy-4'-methoxyisoflavanone (CHEBI:133308) is a hydroxyisoflavanone (CHEBI:72739) |
| 2,5,7-trihydroxy-4'-methoxyisoflavanone (CHEBI:133308) is a lactol (CHEBI:38131) |
| 2,5,7-trihydroxy-4'-methoxyisoflavanone (CHEBI:133308) is a methoxyisoflavanone (CHEBI:72740) |
| IUPAC Name |
|---|
| (2R,3S)-2,5,7-trihydroxy-3-(4-methoxyphenyl)-2,3-dihydro-4H-1-benzopyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| CPD-5421 | MetaCyc |