EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C52H71N7O12 |
| Net Charge | 0 |
| Average Mass | 986.177 |
| Monoisotopic Mass | 985.51607 |
| SMILES | [H][C@@]1(/C=C/C(C)=C/[C@H](C)[C@H](Cc2ccccc2)OC)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](C)[C@H](C(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](C)NC(=O)C(=C)N(C)C(=O)CC[C@H](C(=O)O)NC(=O)[C@H]1C |
| InChI | InChI=1S/C52H71N7O12/c1-29(2)25-40-50(66)58-44(52(69)70)33(6)46(62)56-41(27-36-17-13-11-14-18-36)49(65)54-38(22-21-30(3)26-31(4)42(71-10)28-37-19-15-12-16-20-37)32(5)45(61)55-39(51(67)68)23-24-43(60)59(9)35(8)48(64)53-34(7)47(63)57-40/h11-22,26,29,31-34,38-42,44H,8,23-25,27-28H2,1-7,9-10H3,(H,53,64)(H,54,65)(H,55,61)(H,56,62)(H,57,63)(H,58,66)(H,67,68)(H,69,70)/b22-21+,30-26+/t31-,32-,33-,34+,38-,39+,40-,41-,42-,44+/m0/s1 |
| InChIKey | FEVBMCJUKWWWBT-QVWKUIOOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. cyanotoxin Any toxin produced by cyanobacteria (blue-green algae). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| microcystin LF (CHEBI:133297) has role bacterial metabolite (CHEBI:76969) |
| microcystin LF (CHEBI:133297) has role environmental contaminant (CHEBI:78298) |
| microcystin LF (CHEBI:133297) has role xenobiotic (CHEBI:35703) |
| microcystin LF (CHEBI:133297) is a microcystin (CHEBI:48041) |
| IUPAC Names |
|---|
| (5R,8S,11R,12S,15S,18S,19S,22R)-15-benzyl-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dien-1-yl]-1,5,12,19-tetramethyl-2-methylidene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid |
| cyclo[D-alanyl-L-leucyl-(3S)-3-methyl-D-β-aspartyl-L-phenylalanyl-(2S,3S,4E,6E,8S,9S)-3-amino-4,5,6,7-tetradehydro-9-methoxy-2,6,8-trimethyl-10-phenyldecanoyl-D-γ-glutamyl-2,3-didehydro-N-methylalanyl] |
| Synonym | Source |
|---|---|
| MC-LF | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8753214 | Reaxys |
| CAS:154037-70-4 | ChemIDplus |
| Citations |
|---|