EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H75N13O12 |
| Net Charge | 0 |
| Average Mass | 1038.218 |
| Monoisotopic Mass | 1037.56581 |
| SMILES | [H][C@@]1(/C=C/C(C)=C/[C@H](C)[C@H](Cc2ccccc2)OC)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](C)[C@H](C(=O)O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](C)NC(=O)C(=C)N(C)C(=O)CC[C@H](C(=O)O)NC(=O)[C@H]1C |
| InChI | InChI=1S/C49H75N13O12/c1-26(24-27(2)37(74-8)25-32-14-10-9-11-15-32)18-19-33-28(3)40(64)60-36(46(70)71)20-21-38(63)62(7)31(6)43(67)56-30(5)42(66)59-35(17-13-23-55-49(52)53)45(69)61-39(47(72)73)29(4)41(65)58-34(44(68)57-33)16-12-22-54-48(50)51/h9-11,14-15,18-19,24,27-30,33-37,39H,6,12-13,16-17,20-23,25H2,1-5,7-8H3,(H,56,67)(H,57,68)(H,58,65)(H,59,66)(H,60,64)(H,61,69)(H,70,71)(H,72,73)(H4,50,51,54)(H4,52,53,55)/b19-18+,26-24+/t27-,28-,29-,30+,33-,34-,35-,36+,37-,39+/m0/s1 |
| InChIKey | JIGDOBKZMULDHS-UUHBQKJESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa (ncbitaxon:1126) | - | PubMed (24868986) |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. cyanotoxin Any toxin produced by cyanobacteria (blue-green algae). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| microcystin RR (CHEBI:133296) has role bacterial metabolite (CHEBI:76969) |
| microcystin RR (CHEBI:133296) has role environmental contaminant (CHEBI:78298) |
| microcystin RR (CHEBI:133296) has role xenobiotic (CHEBI:35703) |
| microcystin RR (CHEBI:133296) is a microcystin (CHEBI:48041) |
| microcystin RR (CHEBI:133296) is a organic molecular entity (CHEBI:50860) |
| IUPAC Names |
|---|
| cyclo[D-alanyl-L-arginyl-(3S)-3-methyl-D-β-aspartyl-L-arginyl-(2S,3S,4E,6E,8S,9S)-3-amino-4,5,6,7-tetradehydro-9-methoxy-2,6,8-trimethyl-10-phenyldecanoyl-D-γ-glutamyl-2,3-didehydro-N-methylalanyl] |
| (5R,8S,11R,12S,15S,18S,19S,22R)-8,15-bis(3-carbamimidamidopropyl)-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dien-1-yl]-1,5,12,19-tetramethyl-2-methylidene-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| Cyanoginosin RR | SUBMITTER |
| MC-RR | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 6438357 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| CAS:111755-37-4 | ChemIDplus |
| Citations |
|---|