EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19N3O |
| Net Charge | 0 |
| Average Mass | 221.304 |
| Monoisotopic Mass | 221.15281 |
| SMILES | [H]C(c1nc(C)c(C)nc1C)=[N+]([O-])C(C)(C)C |
| InChI | InChI=1S/C12H19N3O/c1-8-9(2)14-11(10(3)13-8)7-15(16)12(4,5)6/h7H,1-6H3 |
| InChIKey | BESRYENXPUCIID-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-tert-butyl(3,5,6-trimethylpyrazin-2-yl)methanimine N-oxide (CHEBI:133247) has role neuroprotective agent (CHEBI:63726) |
| N-tert-butyl(3,5,6-trimethylpyrazin-2-yl)methanimine N-oxide (CHEBI:133247) has role platelet aggregation inhibitor (CHEBI:50427) |
| N-tert-butyl(3,5,6-trimethylpyrazin-2-yl)methanimine N-oxide (CHEBI:133247) is a nitrone (CHEBI:77477) |
| N-tert-butyl(3,5,6-trimethylpyrazin-2-yl)methanimine N-oxide (CHEBI:133247) is a pyrazines (CHEBI:38314) |
| IUPAC Name |
|---|
| N-tert-butyl(3,5,6-trimethylpyrazin-2-yl)methanimine N-oxide |
| Synonyms | Source |
|---|---|
| 2-[[(1,1-Dimethylethyl)oxidoimino]-methyl]-3,5,6-tri-methylpyrazine | ChEBI |
| TBN | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18904586 | Reaxys |
| CAS:1083171-75-8 | Reaxys |
| Citations |
|---|