EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N2 |
| Net Charge | 0 |
| Average Mass | 136.198 |
| Monoisotopic Mass | 136.10005 |
| SMILES | Cc1nc(C)c(C)nc1C |
| InChI | InChI=1S/C8H12N2/c1-5-6(2)10-8(4)7(3)9-5/h1-4H3 |
| InChIKey | FINHMKGKINIASC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corynebacterium glutamicum (ncbitaxon:1718) | - | Article (European Journal of Organic Chemistry, 2010 , 2687-2695) | |
| Ephedra sinica (ncbitaxon:33152) | - | PubMed (24333010) | |
| Ligusticum wallichii (IPNI:844646-1) | - | PubMed (25841319) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetramethylpyrazine (CHEBI:133246) has role antineoplastic agent (CHEBI:35610) |
| tetramethylpyrazine (CHEBI:133246) has role apoptosis inhibitor (CHEBI:68494) |
| tetramethylpyrazine (CHEBI:133246) has role bacterial metabolite (CHEBI:76969) |
| tetramethylpyrazine (CHEBI:133246) has role neuroprotective agent (CHEBI:63726) |
| tetramethylpyrazine (CHEBI:133246) has role platelet aggregation inhibitor (CHEBI:50427) |
| tetramethylpyrazine (CHEBI:133246) has role vasodilator agent (CHEBI:35620) |
| tetramethylpyrazine (CHEBI:133246) is a alkaloid (CHEBI:22315) |
| tetramethylpyrazine (CHEBI:133246) is a pyrazines (CHEBI:38314) |
| IUPAC Name |
|---|
| tetramethylpyrazine |
| Synonyms | Source |
|---|---|
| 2,3,5,6,-tetramethyl-1,4-pyrazine | MetaCyc |
| 2,3,5,6-tetramethylpyrazine | ChemIDplus |
| FEMA 3237 | ChEBI |
| FEMA No. 3237 | ChemIDplus |
| liqustrazine | ChemIDplus |
| TMP | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| CPD-15901 | MetaCyc |
| HMDB0036584 | HMDB |
| Tetramethylpyrazine | Wikipedia |
| Citations |
|---|