EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20FN5 |
| Net Charge | 0 |
| Average Mass | 301.369 |
| Monoisotopic Mass | 301.17027 |
| SMILES | [H][C@]1(Nc2nc(N)nc([C@@H](C)F)n2)c2cc(C)ccc2C[C@@H]1C |
| InChI | InChI=1S/C16H20FN5/c1-8-4-5-11-7-9(2)13(12(11)6-8)19-16-21-14(10(3)17)20-15(18)22-16/h4-6,9-10,13H,7H2,1-3H3,(H3,18,19,20,21,22)/t9-,10+,13+/m0/s1 |
| InChIKey | YFONKFDEZLYQDH-OPQQBVKSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | cellulose synthesis inhibitor An pathway inhibitor that inhibits the synthesis of cellulose. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(1R,2S)-2,6-dimethyindan-1-yl]-6-[(1R)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine (CHEBI:133238) has role cellulose synthesis inhibitor (CHEBI:63958) |
| N-[(1R,2S)-2,6-dimethyindan-1-yl]-6-[(1R)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine (CHEBI:133238) has role herbicide (CHEBI:24527) |
| N-[(1R,2S)-2,6-dimethyindan-1-yl]-6-[(1R)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine (CHEBI:133238) is a N-(2,6-dimethylindan-1-yl)-6-(1-fluoroethyl)-1,3,5-triazine-2,4-diamine (CHEBI:133240) |
| Incoming Relation(s) |
| indaziflam (CHEBI:133237) has part N-[(1R,2S)-2,6-dimethyindan-1-yl]-6-[(1R)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine (CHEBI:133238) |
| IUPAC Name |
|---|
| N-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-6-[(1R)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine |
| Synonym | Source |
|---|---|
| indaziflam (major isomer) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12024778 | Reaxys |
| CAS:730979-19-8 | ChEBI |