EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13NO.HCl |
| Net Charge | 0 |
| Average Mass | 283.758 |
| Monoisotopic Mass | 283.07639 |
| SMILES | Cl.Oc1ccccc1/C=C/c1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H13NO.ClH/c19-17-8-4-2-6-14(17)10-12-15-11-9-13-5-1-3-7-16(13)18-15;/h1-12,19H;1H/b12-10+; |
| InChIKey | OGGHGIYQZSZPJX-VHPXAQPISA-N |
| Roles Classification |
|---|
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quininib hydrochloride (CHEBI:133234) has part quininib(1+) (CHEBI:133233) |
| quininib hydrochloride (CHEBI:133234) has role angiogenesis inhibitor (CHEBI:48422) |
| quininib hydrochloride (CHEBI:133234) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 2-[(E)-2-(2-hydroxyphenyl)vinyl]quinolinium chloride |
| 2-[(E)-2-(quinolin-2-yl)vinyl]phenol hydrochloride |
| Synonym | Source |
|---|---|
| quininib.HCl | ChEBI |