EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7O5S |
| Net Charge | -1 |
| Average Mass | 215.206 |
| Monoisotopic Mass | 215.00197 |
| SMILES | CC(=O)c1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C8H8O5S/c1-6(9)7-2-4-8(5-3-7)13-14(10,11)12/h2-5H,1H3,(H,10,11,12)/p-1 |
| InChIKey | HOFGLAYWQRGTKC-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-acetylphenyl sulfate (CHEBI:133225) is a phenyl sulfate oxoanion (CHEBI:140317) |
| 4-acetylphenyl sulfate (CHEBI:133225) is conjugate base of 4-acetylphenyl hydrogen sulfate (CHEBI:133226) |
| Incoming Relation(s) |
| 4-acetylphenyl hydrogen sulfate (CHEBI:133226) is conjugate acid of 4-acetylphenyl sulfate (CHEBI:133225) |
| Synonyms | Source |
|---|---|
| 4-acetylphenol sulfate | ChEBI |
| p-acetylphenol sulfate | ChEBI |
| p-acetylphenyl sulfate | ChEBI |