EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9NO3 |
| Net Charge | 0 |
| Average Mass | 191.186 |
| Monoisotopic Mass | 191.05824 |
| SMILES | COc1ccc2nc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C10H9NO3/c1-14-7-2-3-8-6(4-7)5-9(11-8)10(12)13/h2-5,11H,1H3,(H,12,13) |
| InChIKey | YEBJVSLNUMZXRJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | |||
| fruit (BTO:0000486) | MetaboLights (MTBLS107) | ||
| fruit (BTO:0000486) | DOI (10.1007/s11306-014-0728-9) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.8.1.4 (dihydrolipoyl dehydrogenase) inhibitor An EC 1.8.1.* (oxidoreductase acting on sulfur group of donors, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of dihydrolipoyl dehydrogenase (EC 1.8.1.4). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methoxyindole-2-carboxylic acid (CHEBI:133222) has role EC 1.8.1.4 (dihydrolipoyl dehydrogenase) inhibitor (CHEBI:134545) |
| 5-methoxyindole-2-carboxylic acid (CHEBI:133222) has role hypoglycemic agent (CHEBI:35526) |
| 5-methoxyindole-2-carboxylic acid (CHEBI:133222) has role plant metabolite (CHEBI:76924) |
| 5-methoxyindole-2-carboxylic acid (CHEBI:133222) is a aromatic ether (CHEBI:35618) |
| 5-methoxyindole-2-carboxylic acid (CHEBI:133222) is a indolecarboxylic acid (CHEBI:38610) |
| IUPAC Name |
|---|
| 5-methoxy-1H-indole-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5-Methoxy-2-indolecarboxylic acid | ChemIDplus |
| 5-methoxy-2-indolic acid | ChEBI |
| Citations |
|---|