EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40O20 |
| Net Charge | 0 |
| Average Mass | 756.663 |
| Monoisotopic Mass | 756.21129 |
| SMILES | [H][C@@]1(OC[C@H]2O[C@@H](Oc3c(-c4ccc(O)cc4)oc4cc(O[C@@H]5O[C@@H](C)[C@H](O)[C@@H](O)[C@H]5O)cc(O)c4c3=O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C33H40O20/c1-10-19(37)23(41)27(45)32(48-10)49-13-6-14(36)18-15(7-13)50-29(11-2-4-12(35)5-3-11)30(22(18)40)53-33-28(46)25(43)21(39)17(52-33)9-47-31-26(44)24(42)20(38)16(8-34)51-31/h2-7,10,16-17,19-21,23-28,31-39,41-46H,8-9H2,1H3/t10-,16+,17+,19-,20+,21+,23+,24-,25-,26+,27+,28+,31+,32-,33-/m0/s1 |
| InChIKey | QFSDWLPMRWDFID-CSNYLUTCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS129) | ||
| - | PubMed (27432888) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 3-O-gentiobioside-7-O-rhamnoside (CHEBI:133218) has functional parent kaempferol (CHEBI:28499) |
| kaempferol 3-O-gentiobioside-7-O-rhamnoside (CHEBI:133218) has role plant metabolite (CHEBI:76924) |
| kaempferol 3-O-gentiobioside-7-O-rhamnoside (CHEBI:133218) is a dihydroxyflavone (CHEBI:38686) |
| kaempferol 3-O-gentiobioside-7-O-rhamnoside (CHEBI:133218) is a disaccharide derivative (CHEBI:63353) |
| kaempferol 3-O-gentiobioside-7-O-rhamnoside (CHEBI:133218) is a gentiobioside (CHEBI:24215) |
| kaempferol 3-O-gentiobioside-7-O-rhamnoside (CHEBI:133218) is a glycosyloxyflavone (CHEBI:50018) |
| kaempferol 3-O-gentiobioside-7-O-rhamnoside (CHEBI:133218) is a polyphenol (CHEBI:26195) |
| kaempferol 3-O-gentiobioside-7-O-rhamnoside (CHEBI:133218) is a α-L-rhamnoside (CHEBI:27848) |
| IUPAC Name |
|---|
| 7-[(6-deoxy-α-L-mannopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-3-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| kaempferol 3-glucoside-(1→6)-glucoside-7-α-L-rhamnoside | LIPID MAPS |
| Kaempferol 3-gentiobioside-7-rhamnoside | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| kaempferol-3-O-gentiobioside-7-O-rhamnoside | MetaCyc |
| LMPK12111762 | LIPID MAPS |
| C00005234 | KNApSAcK |
| HMDB0034396 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:173740-43-7 | KNApSAcK |