EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O4 |
| Net Charge | 0 |
| Average Mass | 216.237 |
| Monoisotopic Mass | 216.11101 |
| SMILES | CC(=O)NCCC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C9H16N2O4/c1-6(12)10-5-3-4-8(9(14)15)11-7(2)13/h8H,3-5H2,1-2H3,(H,10,12)(H,11,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | XUYANFPPYJSBPU-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisorcic (CHEBI:133217) is a N-acetyl-L-amino acid (CHEBI:21545) |
| bisorcic (CHEBI:133217) is a L-ornithine derivative (CHEBI:21368) |
| bisorcic (CHEBI:133217) is conjugate acid of bisorcic(1−) (CHEBI:133209) |
| Incoming Relation(s) |
| bisorcic(1−) (CHEBI:133209) is conjugate base of bisorcic (CHEBI:133217) |
| IUPAC Name |
|---|
| N2,N5-diacetyl-L-ornithine |
| INNs | Source |
|---|---|
| bisorcicum | ChemIDplus |
| bisorcico | ChemIDplus |
| bisorcic | ChemIDplus |
| Synonym | Source |
|---|---|
| N2,N5-diacetylornithine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 381 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1712784 | Reaxys |
| CAS:39825-23-5 | ChemIDplus |