EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133216 - 26-hydroxycastasterone
| Formula | C28H48O6 |
| Net Charge | 0 |
| Average Mass | 480.686 |
| Monoisotopic Mass | 480.34509 |
| SMILES | [H][C@@]12CC(=O)[C@@]3([H])C[C@H](O)[C@H](O)C[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@H](O)[C@H](O)[C@@H](C)C(C)CO |
| InChI | InChI=1S/C28H48O6/c1-14(13-29)15(2)25(33)26(34)16(3)18-6-7-19-17-10-22(30)21-11-23(31)24(32)12-28(21,5)20(17)8-9-27(18,19)4/h14-21,23-26,29,31-34H,6-13H2,1-5H3/t14?,15-,16-,17-,18+,19-,20-,21+,23-,24+,25+,26+,27+,28+/m0/s1 |
| InChIKey | GIHKVCBPOTYEGP-ZHTUDUEMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS129) | ||
| - | PubMed (27432888) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26-hydroxycastasterone (CHEBI:133216) has functional parent castasterone (CHEBI:23051) |
| 26-hydroxycastasterone (CHEBI:133216) has role plant metabolite (CHEBI:76924) |
| 26-hydroxycastasterone (CHEBI:133216) is a 22-hydroxy steroid (CHEBI:36863) |
| 26-hydroxycastasterone (CHEBI:133216) is a 23-hydroxy steroid (CHEBI:36866) |
| 26-hydroxycastasterone (CHEBI:133216) is a 26-hydroxy steroid (CHEBI:36852) |
| 26-hydroxycastasterone (CHEBI:133216) is a 2α-hydroxy steroid (CHEBI:36858) |
| 26-hydroxycastasterone (CHEBI:133216) is a 3α-hydroxy steroid (CHEBI:36835) |
| 26-hydroxycastasterone (CHEBI:133216) is a 6-oxo steroid (CHEBI:36883) |
| 26-hydroxycastasterone (CHEBI:133216) is a brassinosteroid (CHEBI:22921) |
| IUPAC Name |
|---|
| (22R,23R)-2α,3α,22,23,26-pentahydroxy-5α-campestan-6-one |
| Synonym | Source |
|---|---|
| (2α,3α,5α,22R,23R,24S)-2,3,22,23,26-pentahydroxyergostan-6-one | IUPAC |
| Citations |
|---|