EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N5O6 |
| Net Charge | 0 |
| Average Mass | 381.389 |
| Monoisotopic Mass | 381.16483 |
| SMILES | C/C(=C\CNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)CO |
| InChI | InChI=1S/C16H23N5O6/c1-8(4-22)2-3-17-14-10-15(19-6-18-14)21(7-20-10)16-13(26)12(25)11(24)9(5-23)27-16/h2,6-7,9,11-13,16,22-26H,3-5H2,1H3,(H,17,18,19)/b8-2+/t9-,11-,12+,13-,16-/m1/s1 |
| InChIKey | VYRAJOITMBSQSE-HNVSNYHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | |||
| fruit (BTO:0000486) | MetaboLights (MTBLS107) | ||
| fruit (BTO:0000486) | DOI (10.1007/s11306-014-0728-9) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS111) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS110) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS108) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS109) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-(β-D-glucosyl)-trans-zeatin (CHEBI:133210) has role plant metabolite (CHEBI:76924) |
| 9-(β-D-glucosyl)-trans-zeatin (CHEBI:133210) is a N-glycosylzeatin (CHEBI:38645) |
| 9-(β-D-glucosyl)-trans-zeatin (CHEBI:133210) is a glucosyl-N6-isopentenyladenine (CHEBI:24289) |
| IUPAC Name |
|---|
| 9-β-D-glucopyranosyl-N-[(2E)-4-hydroxy-3-methylbut-2-en-1-yl]-9H-purin-6-amine |
| Synonyms | Source |
|---|---|
| trans-zeatin-9-β-glucoside | ChEBI |
| trans-zeatin-9-glucoside | ChEBI |
| trans-zeatin-9-β-D-glucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8018607 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1231942 | Reaxys |