EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H9NO2 |
| Net Charge | 0 |
| Average Mass | 187.198 |
| Monoisotopic Mass | 187.06333 |
| SMILES | [H]C(=O)c1cn(C(C)=O)c2ccccc12 |
| InChI | InChI=1S/C11H9NO2/c1-8(14)12-6-9(7-13)10-4-2-3-5-11(10)12/h2-7H,1H3 |
| InChIKey | LCJLFGSKHBDOAY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | |||
| fruit (BTO:0000486) | MetaboLights (MTBLS110) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS109) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS108) | ||
| fruit (BTO:0000486) | DOI (10.1007/s11306-014-0728-9) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS107) | ||
| fruit (BTO:0000486) | MetaboLights (MTBLS111) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-acetylindole-3-carboxaldehyde (CHEBI:133207) has role plant metabolite (CHEBI:76924) |
| 1-acetylindole-3-carboxaldehyde (CHEBI:133207) is a N-acylindole (CHEBI:75884) |
| 1-acetylindole-3-carboxaldehyde (CHEBI:133207) is a arenecarbaldehyde (CHEBI:33855) |
| IUPAC Name |
|---|
| 1-acetyl-1H-indole-3-carbaldehyde |
| Synonyms | Source |
|---|---|
| N-acetylindole-3-carboxaldehyde | ChEBI |
| 1-acetyl-3-formylindole | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 81163 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:22948-94-3 | ChemIDplus |