EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18O3 |
| Net Charge | 0 |
| Average Mass | 222.284 |
| Monoisotopic Mass | 222.12559 |
| SMILES | CC(C(=O)O)c1ccc(CC(C)(C)O)cc1 |
| InChI | InChI=1S/C13H18O3/c1-9(12(14)15)11-6-4-10(5-7-11)8-13(2,3)16/h4-7,9,16H,8H2,1-3H3,(H,14,15) |
| InChIKey | UJHKVYPPCJBOSG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyibuprofen (CHEBI:133197) has role drug metabolite (CHEBI:49103) |
| 2-hydroxyibuprofen (CHEBI:133197) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 2-hydroxyibuprofen (CHEBI:133197) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 2-[4-(2-hydroxy-2-methylpropyl)phenyl]propanoic acid |
| Synonyms | Source |
|---|---|
| Hydroxyibuprofen | ChemIDplus |
| Ibuprofen OH | ChemIDplus |
| 2,4'-(2-Hydroxy-2-methylpropyl)phenylpropionic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060920 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3051852 | Reaxys |
| CAS:51146-55-5 | ChemIDplus |
| Citations |
|---|