EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15N3O3 |
| Net Charge | 0 |
| Average Mass | 261.281 |
| Monoisotopic Mass | 261.11134 |
| SMILES | CC(C)[C@]1(C)NC(c2ncccc2C(=O)O)=NC1=O |
| InChI | InChI=1S/C13H15N3O3/c1-7(2)13(3)12(19)15-10(16-13)9-8(11(17)18)5-4-6-14-9/h4-7H,1-3H3,(H,17,18)(H,15,16,19)/t13-/m0/s1 |
| InChIKey | CLQMBPJKHLGMQK-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-imazapyr (CHEBI:133189) is a 2-(4-isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)nicotinic acid (CHEBI:133187) |
| (S)-imazapyr (CHEBI:133189) is conjugate acid of (S)-imazapyr(1−) (CHEBI:133192) |
| (S)-imazapyr (CHEBI:133189) is enantiomer of (R)-imazapyr (CHEBI:133188) |
| Incoming Relation(s) |
| imazapyr (CHEBI:82021) has part (S)-imazapyr (CHEBI:133189) |
| (S)-imazapyr(1−) (CHEBI:133192) is conjugate base of (S)-imazapyr (CHEBI:133189) |
| (R)-imazapyr (CHEBI:133188) is enantiomer of (S)-imazapyr (CHEBI:133189) |
| IUPAC Name |
|---|
| 2-[(4S)-4-isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl]nicotinic acid |
| Synonyms | Source |
|---|---|
| 2-[(S)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]nicotinic acid | ChEBI |
| 2-[(4S)-4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:355841-28-0 | ChemIDplus |
| Citations |
|---|