EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O3 |
| Net Charge | 0 |
| Average Mass | 211.221 |
| Monoisotopic Mass | 211.09569 |
| SMILES | CC(=O)N[C@@H](Cc1cn(C)cn1)C(=O)O |
| InChI | InChI=1S/C9H13N3O3/c1-6(13)11-8(9(14)15)3-7-4-12(2)5-10-7/h4-5,8H,3H2,1-2H3,(H,11,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | GVRCKHXHWSYDEF-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24625756) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-1-methyl-L-histidine (CHEBI:133181) has role human blood serum metabolite (CHEBI:85234) |
| N-acetyl-1-methyl-L-histidine (CHEBI:133181) is a N-acetyl-L-amino acid (CHEBI:21545) |
| N-acetyl-1-methyl-L-histidine (CHEBI:133181) is a L-histidine derivative (CHEBI:84076) |
| N-acetyl-1-methyl-L-histidine (CHEBI:133181) is conjugate acid of N-acetyl-1-methyl-L-histidinate (CHEBI:133182) |
| Incoming Relation(s) |
| N-acetyl-1-methyl-L-histidinate (CHEBI:133182) is conjugate base of N-acetyl-1-methyl-L-histidine (CHEBI:133181) |
| IUPAC Name |
|---|
| N-acetyl-1-methyl-L-histidine |
| Synonym | Source |
|---|---|
| N-acetyl-1-methylhistidine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8315946 | Reaxys |
| Citations |
|---|