EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | CC(=O)NCCCC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C7H14N2O3/c1-5(10)9-4-2-3-6(8)7(11)12/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | SRXKAYJJGAAOBP-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-acetylornithine zwitterion (CHEBI:133180) is a α-amino-acid zwitterion (CHEBI:78608) |
| N5-acetylornithine zwitterion (CHEBI:133180) is tautomer of N5-acetylornithine (CHEBI:133179) |
| Incoming Relation(s) |
| N5-acetylornithine (CHEBI:133179) is tautomer of N5-acetylornithine zwitterion (CHEBI:133180) |
| IUPAC Name |
|---|
| 5-acetamido-2-azaniumylpentanoate |
| Synonyms | Source |
|---|---|
| Nδ-acetylornithine zwitterion | ChEBI |
| δ-acetylornithine zwitterion | ChEBI |
| N-delta-acetylornithine | ChEBI |