EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43NO6 |
| Net Charge | 0 |
| Average Mass | 465.631 |
| Monoisotopic Mass | 465.30904 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=O)NCC(=O)O)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@@H](O)C[C@@]3([H])[C@@H](O)[C@@H](O)[C@@]21[H] |
| InChI | InChI=1S/C26H43NO6/c1-14(4-7-20(29)27-13-21(30)31)16-5-6-17-22-18(9-11-25(16,17)2)26(3)10-8-15(28)12-19(26)23(32)24(22)33/h14-19,22-24,28,32-33H,4-13H2,1-3H3,(H,27,29)(H,30,31)/t14-,15-,16-,17+,18+,19+,22+,23-,24+,25-,26-/m1/s1 |
| InChIKey | ZQYUKJFJPJDMMR-ZDWCHQGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (27458508) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycohyocholic acid (CHEBI:133176) has functional parent hyocholic acid (CHEBI:81244) |
| glycohyocholic acid (CHEBI:133176) has role human metabolite (CHEBI:77746) |
| glycohyocholic acid (CHEBI:133176) is a bile acid glycine conjugate (CHEBI:36255) |
| glycohyocholic acid (CHEBI:133176) is conjugate acid of glycohyocholate (CHEBI:133177) |
| Incoming Relation(s) |
| glycohyocholate (CHEBI:133177) is conjugate base of glycohyocholic acid (CHEBI:133176) |
| IUPAC Name |
|---|
| N-(3α,6α,7α-trihydroxy-5β-cholan-24-oyl)glycine |
| Synonyms | Source |
|---|---|
| N-[(3α,5β,6α,7α)-3,6,7-trihydroxy-24-oxocholan-24-yl]glycine | IUBMB |
| N-hyocholoylglycine | ChEBI |
| hyocholic acid-glycine conjugate | ChEBI |
| Citations |
|---|