EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31BrO2 |
| Net Charge | 0 |
| Average Mass | 335.326 |
| Monoisotopic Mass | 334.15074 |
| SMILES | CCCCCCCCCCCCCCC(Br)C(=O)O |
| InChI | InChI=1S/C16H31BrO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(17)16(18)19/h15H,2-14H2,1H3,(H,18,19) |
| InChIKey | DPRAYRYQQAXQPE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fatty acid oxidation inhibitor A compound that inhibits the oxidation of any fatty acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-bromohexadecanoic acid (CHEBI:133152) has functional parent hexadecanoic acid (CHEBI:15756) |
| 2-bromohexadecanoic acid (CHEBI:133152) has role fatty acid oxidation inhibitor (CHEBI:133190) |
| 2-bromohexadecanoic acid (CHEBI:133152) is a 2-bromocarboxylic acid (CHEBI:134367) |
| 2-bromohexadecanoic acid (CHEBI:133152) is a bromo fatty acid (CHEBI:61709) |
| 2-bromohexadecanoic acid (CHEBI:133152) is a long-chain fatty acid (CHEBI:15904) |
| 2-bromohexadecanoic acid (CHEBI:133152) is a straight-chain fatty acid (CHEBI:59202) |
| IUPAC Name |
|---|
| 2-bromohexadecanoic acid |
| Synonyms | Source |
|---|---|
| 2-bromopalmitic acid | SUBMITTER |
| alpha-bromopalmitic acid | SUBMITTER |
| hexadecanoic acid, 2-bromo- | SUBMITTER |
| α-bromopalmitic acid | ChEBI |
| 2-bromo-hexadecanoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01090011 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726517 | Reaxys |
| CAS:18263-25-7 | ChemIDplus |
| Citations |
|---|