EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O10 |
| Net Charge | 0 |
| Average Mass | 440.445 |
| Monoisotopic Mass | 440.16825 |
| SMILES | Cc1c(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc2c(c1C)OC(C)(CCC(=O)O)CC2 |
| InChI | InChI=1S/C21H28O10/c1-9-10(2)17-11(4-6-21(3,31-17)7-5-13(22)23)8-12(9)29-20-16(26)14(24)15(25)18(30-20)19(27)28/h8,14-16,18,20,24-26H,4-7H2,1-3H3,(H,22,23)(H,27,28)/t14-,15-,16+,18-,20+,21?/m0/s1 |
| InChIKey | NOZSTAZEOBPSBY-LWNJIDTBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (MED:26317986) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-CEHC β-glucuronide (CHEBI:133148) has functional parent γ-CEHC (CHEBI:89379) |
| γ-CEHC β-glucuronide (CHEBI:133148) has role human metabolite (CHEBI:77746) |
| γ-CEHC β-glucuronide (CHEBI:133148) is a chromanes (CHEBI:23230) |
| γ-CEHC β-glucuronide (CHEBI:133148) is a dicarboxylic acid (CHEBI:35692) |
| γ-CEHC β-glucuronide (CHEBI:133148) is a β-D-glucosiduronic acid (CHEBI:15341) |
| γ-CEHC β-glucuronide (CHEBI:133148) is conjugate acid of γ-CEHC β-glucuronide anion (CHEBI:133149) |
| Incoming Relation(s) |
| γ-CEHC β-glucuronide anion (CHEBI:133149) is conjugate base of γ-CEHC β-glucuronide (CHEBI:133148) |
| IUPAC Name |
|---|
| 2-(2-carboxyethyl)-2,7,8-trimethyl-3,4-dihydro-2H-1-benzopyran-6-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| gamma-CEHC glucuronide | ChEBI |
| γ-CEHC β-D-glucuronide | ChEBI |
| 2,7,8-trimethyl-2-(β-carboxyethyl)-6-hydroxychroman β-D-glucuronide | ChEBI |
| 2,7,8-trimethyl-2-(β-carboxyethyl)-6-hydroxychroman β-glucuronide | ChEBI |
| Citations |
|---|