EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31F6N3O3 |
| Net Charge | 0 |
| Average Mass | 535.529 |
| Monoisotopic Mass | 535.22696 |
| SMILES | COC(c1ccc(N(C(=O)c2c(C)nn(C)c2C)C(=O)C(C)C)cc1CC(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H31F6N3O3/c1-13(2)11-17-12-18(9-10-19(17)23(37-8,24(26,27)28)25(29,30)31)34(21(35)14(3)4)22(36)20-15(5)32-33(7)16(20)6/h9-10,12-14H,11H2,1-8H3 |
| InChIKey | DZVWKNFPXMUIFA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyflubumide (CHEBI:133137) is a dicarboximide (CHEBI:35356) |
| pyflubumide (CHEBI:133137) is a ether (CHEBI:25698) |
| pyflubumide (CHEBI:133137) is a organofluorine acaricide (CHEBI:38806) |
| pyflubumide (CHEBI:133137) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-3-isobutylphenyl]-N-isobutyryl-1,3,5-trimethyl-1H-pyrazole-4-carboxamide |
| Synonyms | Source |
|---|---|
| 1,3,5-trimethyl-N-(2-methyl-1-oxopropyl)-N-[3-(2-methylpropyl)-4-[2,2,2-trifluoro-1-methoxy-1-(trifluoromethyl)ethyl]phenyl]-1H-pyrazole-4-carboxamide | Alan Wood's Pesticides |
| N-[4-(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)-3-isobutylphenyl]-N-isobutyryl-1,3,5-trimethyl-1H-pyrazole-4-carboxamide | Alan Wood's Pesticides |
| 3'-isobutyl-N-isobutyryl-1,3,5-trimethyl-4'-[2,2,2-trifluoro-1-methoxy-1-(trifluoromethyl)ethyl]pyrazole-4-carboxanilide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| WO2007020986 | Patent |
| 3070 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12834130 | Reaxys |
| CAS:926914-55-8 | Alan Wood's Pesticides |
| Citations |
|---|